ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4,6-diklor-1H-indol-2-karbonylklorid |
|
produktnavn | 4,6-diklor-1H-indol-2-karbonylklorid |
Engelsk navn | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
Molekylær Formel | C9H4Cl3NO |
Molekylvekt | 248.4932 |
InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
CAS-nummer | 306937-25-7 |
Molecular Structure | ![]() |
Tetthet | 1.632g/cm3 |
Smeltepunkt | 173℃ |
Kokepunkt | 404.9°C at 760 mmHg |
Brytningsindeks | 1.696 |
Flammepunktet | 198.7°C |
Damptrykk | 9.1E-07mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |