Chemindex > 38584-87-1
DE ▼
38584-87-1 2-Ethylhexansäure, Verbindung mit 2,2',2''-Nitrilotriethanol (1:1) |
|
| Produkt-Name | 2-Ethylhexansäure, Verbindung mit 2,2',2''-Nitrilotriethanol (1:1) |
| Synonyme | Hexansäure, 2-Ethyl-, komp.mit 2,2',2''-Nitrilotris(ethanol) (1:1); 2-Ethylhexansäureverbindung mit Triethanolamin (1:1); Triethanolamin-2-ethylhexoat; 2-Ethylhexansäure, Verbindung mit 2,2',2''-Nitrilotriethanol (1:1); 2-Ethylhexansäure-2,2',2''-Nitrilotriethanol (1:1); |
| Englischer Name | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekulare Formel | C14H31NO5 |
| Molecular Weight | 293.3996 |
| InChl | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
| CAS Registry Number | 38584-87-1 |
| EINECS | 254-020-1 |
| Molecular Structure |  |
| Siedepunkt | 228°C at 760 mmHg |
| Flammpunkt | 116.6°C |
| Dampfdruck | 0.027mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 38584-87-1 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 