ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38584-87-1 2-etilhexánsav, vegyület 2,2',2''-nitril-trietanollal (1:1) |
|
termék neve | 2-etilhexánsav, vegyület 2,2',2''-nitril-trietanollal (1:1) |
Szinonimák | Hexánsav, 2-etil-, compd.2,2',2''-nitrilotris (etanol) (1:1); 2-etilhexánsav vegyület trietanol-aminnal (1:1); Trietanol-amin 2-etilhexoát; 2-Etilhexánsav, vegyület 2,2',2''-nitril-trilotrietanollal (1:1); 2-etilhexánsav - 2,2',2''-nitril-trietanol (1:1); |
Angol név | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
MF | C14H31NO5 |
Molekulatömeg | 293.3996 |
InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
CAS-szám | 38584-87-1 |
EINECS | 254-020-1 |
Molekuláris szerkezete | ![]() |
Forráspont | 228°C at 760 mmHg |
Gyulladáspont | 116.6°C |
Gőznyomás | 0.027mmHg at 25°C |
MSDS |