Chemindex > 38584-87-1
TR ▼
38584-87-1 2-etilheksanoik asit, 2,2',2''-nitrilotrianoetanol (1:1) ile bileşik |
|
| Ürün Adı | 2-etilheksanoik asit, 2,2',2''-nitrilotrianoetanol (1:1) ile bileşik |
| Eş anlamlı | Heksanoik asit, 2-etil-, compd.2,2 ', 2 ''-nitrilotris (etanol) (1: 1) ile; Trietanolamin (1:1) içeren 2-Etilheksanoik asit bileşiği; Trietanolamin 2-etilheksoat; 2-Etilheksanoik asit, 2,2',2''-nitrilotrioetanol (1:1) ile bileşik; 2-etilheksanoik asit - 2,2',2''-nitrilotrioetanol (1:1); |
| ingilizce adı | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Moleküler Formülü | C14H31NO5 |
| Molekül Ağırlığı | 293.3996 |
| InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
| CAS kayıt numarası | 38584-87-1 |
| EINECS | 254-020-1 |
| Moleküler Yapısı |  |
| Kaynama noktası | 228°C at 760 mmHg |
| Alevlenme noktası | 116.6°C |
| Buhar basıncı | 0.027mmHg at 25°C |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
38584-87-1 (0) için tedarikçiler:
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 