Chemindex >38584-87-1
MY ▼
38584-87-1 2-asid ethylhexanoic, kompaun dengan 2,2',2'-nitrilotriethanol (1:1) |
|
| Nama produk | 2-asid ethylhexanoic, kompaun dengan 2,2',2'-nitrilotriethanol (1:1) |
| Sinonim | Asid heksana, 2-etil -, akaun.dengan 2,2',2'-Nitrilotris(etanol) (1:1); Sebatian asid 2-Ethylhexanoic dengan triethanolamine (1:1); Triethanolamine 2-ethylhexoate; 2-Asid ethylhexanoic, kompaun dengan 2,2',2'-nitrilotriethanol (1:1); Asid 2-ethylhexanoic - 2,2',2'-nitrilotriethanol (1:1); |
| Nama Inggeris | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| MF | C14H31NO5 |
| Berat Molekul | 293.3996 |
| InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
| CAS NO | 38584-87-1 |
| EINECS | 254-020-1 |
| Struktur Molekul |  |
| Titik didih | 228°C at 760 mmHg |
| Titik nyala | 116.6°C |
| Tekanan wap | 0.027mmHg at 25°C |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 38584-87-1 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 