ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38584-87-1 2-אתילהקסנואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
|
שם המוצר | 2-אתילהקסנואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
נרדפות | חומצה הקסנואית, 2-אתיל-, compd.עם 2,2',2''-nitrilotris (אתנול) (1: 1); 2-תרכובת חומצה אתילהקסנואית עם טריאתנולמין (1: 1); Triethanolamine 2-ethylhexoate; 2-חומצה אתילהקסנואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1); 2-חומצה אתילהקסנואית - 2,2',2''-nitrilotriethanol (1: 1); |
שם אנגלי | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
מולקולרית פורמולה | C14H31NO5 |
משקל מולקולרי | 293.3996 |
InChl | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
מספר CAS | 38584-87-1 |
EINECS | 254-020-1 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 228°C at 760 mmHg |
נקודת הבזק | 116.6°C |
לחץ אדים | 0.027mmHg at 25°C |
MSDS |