ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38584-87-1 2-एथिलहेक्सानोइक एसिड, 2,2', 2 ''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | 2-एथिलहेक्सानोइक एसिड, 2,2', 2 ''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक |
समानार्थी | हेक्सानोइक एसिड, 2-एथिल-, compd।2,2', 2''-नाइट्रिलोट्रिस (इथेनॉल) (1: 1) के साथ; 2-एथिलहेक्सानोइक एसिड यौगिक ट्राइथेनॉलमाइन (1: 1) के साथ; ट्राइथेनॉलमाइन 2-एथिलहेक्सोएट; 2-एथिलहेक्सानोइक एसिड, 2,2', 2''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक; 2-एथिलहेक्सानोइक एसिड - 2,2', 2 ''-नाइट्रिलोट्रिथेनॉल (1: 1); |
अंग्रेज | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
आणविक फार्मूला | C14H31NO5 |
आण्विक वजन | 293.3996 |
InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
कैस रजिस्टी संख्या | 38584-87-1 |
EINECS | 254-020-1 |
आणविक संरचना | ![]() |
उबलने का समय | 228°C at 760 mmHg |
फ्लैश प्वाइंट | 116.6°C |
वाष्प का दबाव | 0.027mmHg at 25°C |
MSDS |