ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38584-87-1 Asam 2-etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1) |
|
Nama produk | Asam 2-etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1) |
Sinonim | Asam heksanoat, 2-etil-, compd.dengan 2,2',2''-nitrilotris(etanol) (1:1); Senyawa asam 2-Etilheksanoat dengan trietanolamina (1: 1); Trietanolamina 2-etilheksoat; Asam 2-Etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1); Asam 2-etilheksanoat - 2,2',2''-nitrilotrietanol (1:1); |
Nama bahasa Inggris | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
MF | C14H31NO5 |
Berat Molekul | 293.3996 |
InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
CAS NO | 38584-87-1 |
EINECS | 254-020-1 |
Struktur Molekul | ![]() |
Titik didih | 228°C at 760 mmHg |
Titik nyala | 116.6°C |
Tekanan uap | 0.027mmHg at 25°C |
MSDS |