Chemindex > 38584-87-1
ID ▼
38584-87-1 Asam 2-etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1) |
|
| Nama produk | Asam 2-etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1) |
| Sinonim | Asam heksanoat, 2-etil-, compd.dengan 2,2',2''-nitrilotris(etanol) (1:1); Senyawa asam 2-Etilheksanoat dengan trietanolamina (1: 1); Trietanolamina 2-etilheksoat; Asam 2-Etilheksanoat, senyawa dengan 2,2',2''-nitrilotrietanol (1:1); Asam 2-etilheksanoat - 2,2',2''-nitrilotrietanol (1:1); |
| Nama bahasa Inggris | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| MF | C14H31NO5 |
| Berat Molekul | 293.3996 |
| InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
| CAS NO | 38584-87-1 |
| EINECS | 254-020-1 |
| Struktur Molekul |  |
| Titik didih | 228°C at 760 mmHg |
| Titik nyala | 116.6°C |
| Tekanan uap | 0.027mmHg at 25°C |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 38584-87-1 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 