Chemindex > 38584-87-1
NO ▼
38584-87-1 2-etylheksansyre, sammensatt med 2,2',2''-nitrilotrietanol (1:1) |
|
| produktnavn | 2-etylheksansyre, sammensatt med 2,2',2''-nitrilotrietanol (1:1) |
| Synonymer | Heksansyre, 2-etyl-, compd.med 2,2',2''-nitrilotris (etanol) (1:1); 2-etylheksansyreforbindelse med trietanolamin (1:1); Trietanolamin 2-etylheksoat; 2-etylheksansyre, sammensatt med 2,2',2''-nitrilotrietanol (1:1); 2-etylheksansyre - 2,2',2''-nitrilotrietanol (1:1); |
| Engelsk navn | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekylær Formel | C14H31NO5 |
| Molekylvekt | 293.3996 |
| InChI | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
| CAS-nummer | 38584-87-1 |
| EINECS | 254-020-1 |
| Molecular Structure |  |
| Kokepunkt | 228°C at 760 mmHg |
| Flammepunktet | 116.6°C |
| Damptrykk | 0.027mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 38584-87-1 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 