ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| Produkt-Name | 2-Methoxyacetophenone |
| Englischer Name | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| Molekulare Formel | C9H10O2 |
| Molecular Weight | 150.1745 |
| InChl | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS Registry Number | 4079-52-1 |
| EINECS | 223-802-4 |
| Molecular Structure | ![]() |
| Dichte | 1.035g/cm3 |
| Schmelzpunkt | 7-8℃ |
| Siedepunkt | 245°C at 760 mmHg |
| Brechungsindex | 1.504 |
| Flammpunkt | 92.8°C |
| Dampfdruck | 0.0294mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |