ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| उत्पाद का नाम | 2-Methoxyacetophenone |
| अंग्रेज | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| आणविक फार्मूला | C9H10O2 |
| आण्विक वजन | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| कैस रजिस्टी संख्या | 4079-52-1 |
| EINECS | 223-802-4 |
| आणविक संरचना | ![]() |
| घनत्व | 1.035g/cm3 |
| गलनांक | 7-8℃ |
| उबलने का समय | 245°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.504 |
| फ्लैश प्वाइंट | 92.8°C |
| वाष्प का दबाव | 0.0294mmHg at 25°C |
| सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |