ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| termék neve | 2-Methoxyacetophenone |
| Angol név | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| MF | C9H10O2 |
| Molekulatömeg | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS-szám | 4079-52-1 |
| EINECS | 223-802-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.035g/cm3 |
| Olvadáspont | 7-8℃ |
| Forráspont | 245°C at 760 mmHg |
| Törésmutató | 1.504 |
| Gyulladáspont | 92.8°C |
| Gőznyomás | 0.0294mmHg at 25°C |
| Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |