ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| Ürün Adı | 2-Methoxyacetophenone |
| ingilizce adı | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| Moleküler Formülü | C9H10O2 |
| Molekül Ağırlığı | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS kayıt numarası | 4079-52-1 |
| EINECS | 223-802-4 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.035g/cm3 |
| Ergime noktası | 7-8℃ |
| Kaynama noktası | 245°C at 760 mmHg |
| Kırılma indisi | 1.504 |
| Alevlenme noktası | 92.8°C |
| Buhar basıncı | 0.0294mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |