ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| Nome del prodotto | 2-Methoxyacetophenone |
| Nome inglese | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| Formula molecolare | C9H10O2 |
| Peso Molecolare | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| Numero CAS | 4079-52-1 |
| EINECS | 223-802-4 |
| Struttura molecolare | ![]() |
| Densità | 1.035g/cm3 |
| Punto di fusione | 7-8℃ |
| Punto di ebollizione | 245°C at 760 mmHg |
| Indice di rifrazione | 1.504 |
| Punto d'infiammabilità | 92.8°C |
| Pressione di vapore | 0.0294mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |