ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| Nome do produto | 2-Methoxyacetophenone |
| Nome em inglês | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| Fórmula molecular | C9H10O2 |
| Peso Molecular | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS Registry Number | 4079-52-1 |
| EINECS | 223-802-4 |
| Estrutura Molecular | ![]() |
| Densidade | 1.035g/cm3 |
| Ponto de fusão | 7-8℃ |
| Ponto de ebulição | 245°C at 760 mmHg |
| índice de refração | 1.504 |
| O ponto de inflamação | 92.8°C |
| Pressão de vapor | 0.0294mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |