ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| Nama produk | 2-Methoxyacetophenone |
| Nama bahasa Inggris | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| MF | C9H10O2 |
| Berat Molekul | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS NO | 4079-52-1 |
| EINECS | 223-802-4 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.035g/cm3 |
| Titik lebur | 7-8℃ |
| Titik didih | 245°C at 760 mmHg |
| Indeks bias | 1.504 |
| Titik nyala | 92.8°C |
| Tekanan uap | 0.0294mmHg at 25°C |
| Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |