ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4079-52-1 2-Methoxyacetophenone |
|
| produktnavn | 2-Methoxyacetophenone |
| Engelsk navn | 2-Methoxyacetophenone;2-Acetylanisole;alpha-Methoxyacetophenone;2-methoxy-1-phenylethanone;1-(2-methoxyphenyl)ethanone |
| Molekylær Formel | C9H10O2 |
| Molekylvekt | 150.1745 |
| InChI | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS-nummer | 4079-52-1 |
| EINECS | 223-802-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.035g/cm3 |
| Smeltepunkt | 7-8℃ |
| Kokepunkt | 245°C at 760 mmHg |
| Brytningsindeks | 1.504 |
| Flammepunktet | 92.8°C |
| Damptrykk | 0.0294mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |