ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-furánkarbothioamid |
|
termék neve | 3-furánkarbothioamid |
Szinonimák | furán-3-karbothioamid; |
Angol név | 3-furancarbothioamide;furan-3-carbothioamide |
MF | C5H5NOS |
Molekulatömeg | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
CAS-szám | 59918-68-2 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.287g/cm3 |
Olvadáspont | 74℃ |
Forráspont | 219.6°C at 760 mmHg |
Törésmutató | 1.62 |
Gyulladáspont | 86.6°C |
Gőznyomás | 0.118mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |