Chemindex > 59918-68-2
IL ▼
59918-68-2 3-furancarbothioamide |
|
| שם המוצר | 3-furancarbothioamide |
| נרדפות | פוראן-3-carbothioamide; |
| שם אנגלי | 3-furancarbothioamide;furan-3-carbothioamide |
| מולקולרית פורמולה | C5H5NOS |
| משקל מולקולרי | 127.1643 |
| InChl | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| מספר CAS | 59918-68-2 |
| מבנה מולקולרי |  |
| צפיפות | 1.287g/cm3 |
| נקודת ההתוך | 74℃ |
| נקודת רתיחה | 219.6°C at 760 mmHg |
| משקל סגולי | 1.62 |
| נקודת הבזק | 86.6°C |
| לחץ אדים | 0.118mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful:; |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 59918-68-2 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 