ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-furaancarbothioamide |
|
Naam product | 3-furaancarbothioamide |
Synoniemen | furaan-3-carbothioamide; |
Engelse naam | 3-furancarbothioamide;furan-3-carbothioamide |
MF | C5H5NOS |
Molecuulgewicht | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
CAS-nummer | 59918-68-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.287g/cm3 |
Smeltpunt | 74℃ |
Kookpunt | 219.6°C at 760 mmHg |
Brekingsindex | 1.62 |
Vlampunt | 86.6°C |
Dampdruk | 0.118mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |