ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-furancarbothioamid |
|
Ürün Adı | 3-furancarbothioamid |
Eş anlamlı | furan-3-karbothioamid; |
ingilizce adı | 3-furancarbothioamide;furan-3-carbothioamide |
Moleküler Formülü | C5H5NOS |
Molekül Ağırlığı | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
CAS kayıt numarası | 59918-68-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.287g/cm3 |
Ergime noktası | 74℃ |
Kaynama noktası | 219.6°C at 760 mmHg |
Kırılma indisi | 1.62 |
Alevlenme noktası | 86.6°C |
Buhar basıncı | 0.118mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |