ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-furancarbothioamide؛ فوران-3-carbothioamide؛ |
|
نام محصول | 3-furancarbothioamide؛ فوران-3-carbothioamide؛ |
نام انگلیسی | 3-furancarbothioamide;furan-3-carbothioamide |
میدان مغناطیسی | C5H5NOS |
وزن مولکولی | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
شماره سیایاس | 59918-68-2 |
ساختار مولکولی | ![]() |
تراکم | 1.287g/cm3 |
نقطه ذوب | 74℃ |
نقطه غلیان | 219.6°C at 760 mmHg |
ضریب شکست | 1.62 |
نقطه اشتعال | 86.6°C |
فشار بخار | 0.118mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |