ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-फुरानकार्बोथियोमाइड |
|
उत्पाद का नाम | 3-फुरानकार्बोथियोमाइड |
समानार्थी | फुरान -3-कार्बोथियोमाइड; |
अंग्रेज | 3-furancarbothioamide;furan-3-carbothioamide |
आणविक फार्मूला | C5H5NOS |
आण्विक वजन | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
कैस रजिस्टी संख्या | 59918-68-2 |
आणविक संरचना | ![]() |
घनत्व | 1.287g/cm3 |
गलनांक | 74℃ |
उबलने का समय | 219.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.62 |
फ्लैश प्वाइंट | 86.6°C |
वाष्प का दबाव | 0.118mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |