ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59918-68-2 3-furankarbobotioamid |
|
Nazwa produktu: | 3-furankarbobotioamid |
Synonimy | furan-3-karbotioamid; |
Angielska nazwa | 3-furancarbothioamide;furan-3-carbothioamide |
MF | C5H5NOS |
Masie cząsteczkowej | 127.1643 |
InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
Nr CAS | 59918-68-2 |
Struktury molekularnej | ![]() |
Gęstość | 1.287g/cm3 |
Temperatura topnienia | 74℃ |
Temperatura wrzenia | 219.6°C at 760 mmHg |
Współczynnik załamania | 1.62 |
Temperatura zapłonu | 86.6°C |
Ciśnienie pary | 0.118mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |