Chemindex >59918-68-2
MY ▼
59918-68-2 3-furancarbothioamide |
|
| Nama produk | 3-furancarbothioamide |
| Sinonim | Furan-3-Carbothioamide; |
| Nama Inggeris | 3-furancarbothioamide;furan-3-carbothioamide |
| MF | C5H5NOS |
| Berat Molekul | 127.1643 |
| InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| CAS NO | 59918-68-2 |
| Struktur Molekul |  |
| Kepadatan | 1.287g/cm3 |
| Titik lebur | 74℃ |
| Titik didih | 219.6°C at 760 mmHg |
| Indeks bias | 1.62 |
| Titik nyala | 86.6°C |
| Tekanan wap | 0.118mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 59918-68-2 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 