ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
název výrobku | Pentamethylphenylacetonitrile |
Anglický název | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
Molekulární vzorec | C13H17N |
Molekulová hmotnost | 187.2808 |
InChl | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
Registrační číslo CAS | 34688-70-5 |
Molekulární struktura | ![]() |
Hustota | 0.95g/cm3 |
Bod tání | 105-107℃ |
Bod varu | 325.9°C at 760 mmHg |
Index lomu | 1.519 |
Bod vzplanutí | 160.2°C |
Tlak par | 0.000224mmHg at 25°C |
Riziko Codes | R20/22##Harmful by inhalation and if swallowed.:; |
Bezpečnostní Popis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |