Chemindex > 34688-70-5
KR ▼
34688-70-5 Pentamethylphenylacetonitrile |
|
| 상품명칭 | Pentamethylphenylacetonitrile |
| 영문 이름 | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
| 분자식 | C13H17N |
| 분자량 | 187.2808 |
| InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
| cas번호 | 34688-70-5 |
| 분자 구조 |  |
| 밀도 | 0.95g/cm3 |
| 녹는 점 | 105-107℃ |
| 비등점 | 325.9°C at 760 mmHg |
| 굴절 지수 | 1.519 |
| 인화점 | 160.2°C |
| 증기압 | 0.000224mmHg at 25°C |
| 리스크 규칙 | R20/22##Harmful by inhalation and if swallowed.:; |
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 