ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
termék neve | Pentamethylphenylacetonitrile |
Angol név | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
MF | C13H17N |
Molekulatömeg | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS-szám | 34688-70-5 |
Molekuláris szerkezete | ![]() |
Sűrűség | 0.95g/cm3 |
Olvadáspont | 105-107℃ |
Forráspont | 325.9°C at 760 mmHg |
Törésmutató | 1.519 |
Gyulladáspont | 160.2°C |
Gőznyomás | 0.000224mmHg at 25°C |
Kockázatot kódok | R20/22##Harmful by inhalation and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |