ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
Nama produk | Pentamethylphenylacetonitrile |
Nama Inggeris | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
MF | C13H17N |
Berat Molekul | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS NO | 34688-70-5 |
Struktur Molekul | ![]() |
Kepadatan | 0.95g/cm3 |
Titik lebur | 105-107℃ |
Titik didih | 325.9°C at 760 mmHg |
Indeks bias | 1.519 |
Titik nyala | 160.2°C |
Tekanan wap | 0.000224mmHg at 25°C |
Kod Risiko | R20/22##Harmful by inhalation and if swallowed.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |