ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
Ürün Adı | Pentamethylphenylacetonitrile |
ingilizce adı | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
Moleküler Formülü | C13H17N |
Molekül Ağırlığı | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS kayıt numarası | 34688-70-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.95g/cm3 |
Ergime noktası | 105-107℃ |
Kaynama noktası | 325.9°C at 760 mmHg |
Kırılma indisi | 1.519 |
Alevlenme noktası | 160.2°C |
Buhar basıncı | 0.000224mmHg at 25°C |
Risk Kodları | R20/22##Harmful by inhalation and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |