ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
produktnavn | Pentamethylphenylacetonitrile |
Engelsk navn | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
Molekylær Formel | C13H17N |
Molekylvekt | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS-nummer | 34688-70-5 |
Molecular Structure | ![]() |
Tetthet | 0.95g/cm3 |
Smeltepunkt | 105-107℃ |
Kokepunkt | 325.9°C at 760 mmHg |
Brytningsindeks | 1.519 |
Flammepunktet | 160.2°C |
Damptrykk | 0.000224mmHg at 25°C |
Risiko Koder | R20/22##Harmful by inhalation and if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |