ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
उत्पाद का नाम | Pentamethylphenylacetonitrile |
अंग्रेज | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
आणविक फार्मूला | C13H17N |
आण्विक वजन | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
कैस रजिस्टी संख्या | 34688-70-5 |
आणविक संरचना | ![]() |
घनत्व | 0.95g/cm3 |
गलनांक | 105-107℃ |
उबलने का समय | 325.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.519 |
फ्लैश प्वाइंट | 160.2°C |
वाष्प का दबाव | 0.000224mmHg at 25°C |
खतरे के कोड | R20/22##Harmful by inhalation and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |