ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
Nazwa produktu: | Pentamethylphenylacetonitrile |
Angielska nazwa | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
MF | C13H17N |
Masie cząsteczkowej | 187.2808 |
InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
Nr CAS | 34688-70-5 |
Struktury molekularnej | ![]() |
Gęstość | 0.95g/cm3 |
Temperatura topnienia | 105-107℃ |
Temperatura wrzenia | 325.9°C at 760 mmHg |
Współczynnik załamania | 1.519 |
Temperatura zapłonu | 160.2°C |
Ciśnienie pary | 0.000224mmHg at 25°C |
Kody ryzyka | R20/22##Harmful by inhalation and if swallowed.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |