ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34688-70-5 Pentamethylphenylacetonitrile |
|
שם המוצר | Pentamethylphenylacetonitrile |
שם אנגלי | Pentamethylphenylacetonitrile;2,3,4,5,6-Pentamethylbenzyl cyanide |
מולקולרית פורמולה | C13H17N |
משקל מולקולרי | 187.2808 |
InChl | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
מספר CAS | 34688-70-5 |
מבנה מולקולרי | ![]() |
צפיפות | 0.95g/cm3 |
נקודת ההתוך | 105-107℃ |
נקודת רתיחה | 325.9°C at 760 mmHg |
משקל סגולי | 1.519 |
נקודת הבזק | 160.2°C |
לחץ אדים | 0.000224mmHg at 25°C |
סיכונים קודי | R20/22##Harmful by inhalation and if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |