10401-11-3 3-Hydroxyphenylacetylene |
|
| Product Name | 3-Hydroxyphenylacetylene |
| Synonyms | 3-Ethynylphenol |
| Molecular Formula | C8H6O |
| Molecular Weight | 118.1326 |
| InChl | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS Registry Number | 10401-11-3 |
| Molecular Structure |  |
| Density | 1.12g/cm3 |
| Boiling Point | 230.9°C at 760 mmHg |
| Refractive Index | 1.589 |
| Flash Point | 106.1°C |
| Vapour Pressur | 0.0424mmHg at 25°C |
| Risk Codes | R36/38##Irritating to eyes and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
Chemindex > 10401-11-3 3-Hydroxyphenylacetylene