ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-chloro-4-methylthiophene-2-carboxylic acid |
|
| Chemical Name | 3-chloro-4-methylthiophene-2-carboxylic acid |
| Molecular Formula | C6H5ClO2S |
| Molecular Weight | 176.6207 |
| InChl | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS Registry Number | 229342-86-3 |
| Molecular Structure | ![]() |
| Density | 1.475g/cm3 |
| Melting Point | 221℃ |
| Boiling Point | 298.7°C at 760 mmHg |
| Refractive Index | 1.606 |
| Flash Point | 134.4°C |
| Vapour Pressur | 0.000558mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |