ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-chloor-4-methylthiofeen-2-carbonzuur |
|
| Naam product | 3-chloor-4-methylthiofeen-2-carbonzuur |
| Engelse naam | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| MF | C6H5ClO2S |
| Molecuulgewicht | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS-nummer | 229342-86-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.475g/cm3 |
| Smeltpunt | 221℃ |
| Kookpunt | 298.7°C at 760 mmHg |
| Brekingsindex | 1.606 |
| Vlampunt | 134.4°C |
| Dampdruk | 0.000558mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |