Chemindex >229342-86-3
MY ▼
229342-86-3 3-chloro-4-methylthiophene-2-asid karboksilik |
|
| Nama produk | 3-chloro-4-methylthiophene-2-asid karboksilik |
| Nama Inggeris | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| MF | C6H5ClO2S |
| Berat Molekul | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS NO | 229342-86-3 |
| Struktur Molekul |  |
| Kepadatan | 1.475g/cm3 |
| Titik lebur | 221℃ |
| Titik didih | 298.7°C at 760 mmHg |
| Indeks bias | 1.606 |
| Titik nyala | 134.4°C |
| Tekanan wap | 0.000558mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 229342-86-3 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 