ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-kloro-4-metiltiyofen-2-karboksilik asit |
|
| Ürün Adı | 3-kloro-4-metiltiyofen-2-karboksilik asit |
| Eş anlamlı | |
| ingilizce adı | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| Moleküler Formülü | C6H5ClO2S |
| Molekül Ağırlığı | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS kayıt numarası | 229342-86-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.475g/cm3 |
| Ergime noktası | 221℃ |
| Kaynama noktası | 298.7°C at 760 mmHg |
| Kırılma indisi | 1.606 |
| Alevlenme noktası | 134.4°C |
| Buhar basıncı | 0.000558mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |