ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-Chlor-4-methylthiophen-2-carbonsäure |
|
| Produkt-Name | 3-Chlor-4-methylthiophen-2-carbonsäure |
| Englischer Name | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| Molekulare Formel | C6H5ClO2S |
| Molecular Weight | 176.6207 |
| InChl | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS Registry Number | 229342-86-3 |
| Molecular Structure | ![]() |
| Dichte | 1.475g/cm3 |
| Schmelzpunkt | 221℃ |
| Siedepunkt | 298.7°C at 760 mmHg |
| Brechungsindex | 1.606 |
| Flammpunkt | 134.4°C |
| Dampfdruck | 0.000558mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R34##Causes burns.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |