ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 kwas 3-chloro-4-metylotiofeno-2-karboksylowy |
|
| Nazwa produktu: | kwas 3-chloro-4-metylotiofeno-2-karboksylowy |
| Angielska nazwa | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| MF | C6H5ClO2S |
| Masie cząsteczkowej | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| Nr CAS | 229342-86-3 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.475g/cm3 |
| Temperatura topnienia | 221℃ |
| Temperatura wrzenia | 298.7°C at 760 mmHg |
| Współczynnik załamania | 1.606 |
| Temperatura zapłonu | 134.4°C |
| Ciśnienie pary | 0.000558mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R34##Causes burns.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |