ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-chloro-4-methylthiophene-2-کربوکسیلیک اسید؛ | 
    |
| نام محصول | 3-chloro-4-methylthiophene-2-کربوکسیلیک اسید؛ | 
| نام انگلیسی | 3-chloro-4-methylthiophene-2-carboxylic acid; | 
| میدان مغناطیسی | C6H5ClO2S | 
| وزن مولکولی | 176.6207 | 
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) | 
| شماره سیایاس | 229342-86-3 | 
| ساختار مولکولی | ![]()  | 
    
| تراکم | 1.475g/cm3 | 
| نقطه ذوب | 221℃ | 
| نقطه غلیان | 298.7°C at 760 mmHg | 
| ضریب شکست | 1.606 | 
| نقطه اشتعال | 134.4°C | 
| فشار بخار | 0.000558mmHg at 25°C | 
| خطر نمادها | |
| کدهای خطر | R34##Causes burns.:; | 
    
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |