ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 acido 3-cloro-4-metiltiofene-2-carbossilico |
|
| Nome del prodotto | acido 3-cloro-4-metiltiofene-2-carbossilico |
| Nome inglese | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| Formula molecolare | C6H5ClO2S |
| Peso Molecolare | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| Numero CAS | 229342-86-3 |
| Struttura molecolare | ![]() |
| Densità | 1.475g/cm3 |
| Punto di fusione | 221℃ |
| Punto di ebollizione | 298.7°C at 760 mmHg |
| Indice di rifrazione | 1.606 |
| Punto d'infiammabilità | 134.4°C |
| Pressione di vapore | 0.000558mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |