ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-klor-4-metyltiofen-2-karboksylsyre |
|
| produktnavn | 3-klor-4-metyltiofen-2-karboksylsyre |
| Engelsk navn | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| Molekylær Formel | C6H5ClO2S |
| Molekylvekt | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| CAS-nummer | 229342-86-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.475g/cm3 |
| Smeltepunkt | 221℃ |
| Kokepunkt | 298.7°C at 760 mmHg |
| Brytningsindeks | 1.606 |
| Flammepunktet | 134.4°C |
| Damptrykk | 0.000558mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |