ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229342-86-3 3-클로로-4-메틸티오펜-2-카르복실산 |
|
| 상품명칭 | 3-클로로-4-메틸티오펜-2-카르복실산 |
| 영문 이름 | 3-chloro-4-methylthiophene-2-carboxylic acid; |
| 분자식 | C6H5ClO2S |
| 분자량 | 176.6207 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| cas번호 | 229342-86-3 |
| 분자 구조 | ![]() |
| 밀도 | 1.475g/cm3 |
| 녹는 점 | 221℃ |
| 비등점 | 298.7°C at 760 mmHg |
| 굴절 지수 | 1.606 |
| 인화점 | 134.4°C |
| 증기압 | 0.000558mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |