ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-methyl-3-fenyl-4-isoxazolylisothiokyanát |
|
| název výrobku | 5-methyl-3-fenyl-4-isoxazolylisothiokyanát |
| Synonyma | 4-isothiocyanato-5-methyl-3-fenylisoxazol; |
| Anglický název | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| Molekulární vzorec | C11H8N2OS |
| Molekulová hmotnost | 216.259 |
| InChl | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| Registrační číslo CAS | 306934-97-4 |
| Molekulární struktura | ![]() |
| Hustota | 1.22g/cm3 |
| Bod tání | 65℃ |
| Bod varu | 397.9°C at 760 mmHg |
| Index lomu | 1.63 |
| Bod vzplanutí | 194.4°C |
| Tlak par | 3.52E-06mmHg at 25°C |
| Symbolů nebezpečnosti | |
| Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |