ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-מתיל-3-פניל-4-איזוקסזוליל איזותיוציאנט |
|
| שם המוצר | 5-מתיל-3-פניל-4-איזוקסזוליל איזותיוציאנט |
| נרדפות | 4-isothiocyanato-5-methyl-3-phenylisoxazole; |
| שם אנגלי | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| מולקולרית פורמולה | C11H8N2OS |
| משקל מולקולרי | 216.259 |
| InChl | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| מספר CAS | 306934-97-4 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.22g/cm3 |
| נקודת ההתוך | 65℃ |
| נקודת רתיחה | 397.9°C at 760 mmHg |
| משקל סגולי | 1.63 |
| נקודת הבזק | 194.4°C |
| לחץ אדים | 3.52E-06mmHg at 25°C |
| Hazard סימנים | |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |