ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-ميثيل-3-فينيل-4-إيزوكسازول أيزوثيوسيانات ؛ 4-إيزوثيوسياناتو-5-ميثيل-3-فينيل إيزوكسازول ؛ |
|
| اسم المنتج | 5-ميثيل-3-فينيل-4-إيزوكسازول أيزوثيوسيانات ؛ 4-إيزوثيوسياناتو-5-ميثيل-3-فينيل إيزوكسازول ؛ |
| الاسم بالانجليزية | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| الصيغة الجزيئية | C11H8N2OS |
| الوزن الجزيئي الغرامي | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| إستراتيجية المساعدة القطرية | 306934-97-4 |
| بنية جزيئية | ![]() |
| كثافة | 1.22g/cm3 |
| درجة الإنصهار | 65℃ |
| نقطة الغليان | 397.9°C at 760 mmHg |
| معامل الإنكسار | 1.63 |
| نقطة الوميض | 194.4°C |
| ضغط البخار | 3.52E-06mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |