ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-metil-3-fenil-4-izoxazolil-izotiocianát |
|
| termék neve | 5-metil-3-fenil-4-izoxazolil-izotiocianát |
| Szinonimák | 4-izotiocianáto-5-metil-3-fenil-izoxazol; |
| Angol név | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| MF | C11H8N2OS |
| Molekulatömeg | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| CAS-szám | 306934-97-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.22g/cm3 |
| Olvadáspont | 65℃ |
| Forráspont | 397.9°C at 760 mmHg |
| Törésmutató | 1.63 |
| Gyulladáspont | 194.4°C |
| Gőznyomás | 3.52E-06mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |