ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-metil-3-fenil-4-isoksazolil isothiocyanate |
|
| Nama produk | 5-metil-3-fenil-4-isoksazolil isothiocyanate |
| Sinonim | 4-isothiocyanato-5-metil-3-fenilisoksazol; |
| Nama bahasa Inggris | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| MF | C11H8N2OS |
| Berat Molekul | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| CAS NO | 306934-97-4 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.22g/cm3 |
| Titik lebur | 65℃ |
| Titik didih | 397.9°C at 760 mmHg |
| Indeks bias | 1.63 |
| Titik nyala | 194.4°C |
| Tekanan uap | 3.52E-06mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |